CAS 89346-82-7 appears in our catalog under these names: 1-Phenyl-2,5,8,11-tetraoxatridecan-13-yl 4-methylbenzenesulfonate, 95%, Benzyl–PEG4–Ots, 1-Phenyl-2,5,8,11-tetraoxatridecan-13-yl 4-methylbenzenesulfonate, 97%, 97%, Benzyl-PEG4-Ots, 97.0%, 1-PHENYL-2,5,8,11-TETRAOXATRIDECAN-13-YL 4-METHYLBENZENESULFONATE, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g, 500 mg, 1 g.
2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 89346-82-7) is a chemical compound with the molecular formula C22H30O7S and a molecular weight of 438.5 g/mol. IUPAC name: 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: VDKAUDYAZGYGDM-UHFFFAOYSA-N.
| Molecular formula | C22H30O7S |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | VDKAUDYAZGYGDM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)