CAS 893577-41-8 is the registry number for N-[(3,4-Dichlorophenyl)methyl]cyclohexanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(3,4-dichlorophenyl)methyl]cyclohexanamine (CAS 893577-41-8) is a chemical compound with the molecular formula C13H17Cl2N and a molecular weight of 258.18 g/mol. IUPAC name: N-[(3,4-dichlorophenyl)methyl]cyclohexanamine. InChIKey: PEZCMQDKHGXWKH-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2N |
|---|---|
| Molecular weight | 258.18 g/mol |
| IUPAC name | N-[(3,4-dichlorophenyl)methyl]cyclohexanamine |
| InChIKey | PEZCMQDKHGXWKH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)