CAS 89365-25-3 is the registry number for Regadenoson Impurity 54. Offered by: Chemat Brand. Available pack sizes: on request.
(2,6-dihydrazinyl-7H-purin-8-yl)hydrazine (CAS 89365-25-3) is a chemical compound with the molecular formula C5H10N10 and a molecular weight of 210.20 g/mol. IUPAC name: (2,6-dihydrazinyl-7H-purin-8-yl)hydrazine. InChIKey: HHWMHGJYHNMANC-UHFFFAOYSA-N.
| Molecular formula | C5H10N10 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | (2,6-dihydrazinyl-7H-purin-8-yl)hydrazine |
| InChIKey | HHWMHGJYHNMANC-UHFFFAOYSA-N |
| SMILES | C12=C(N=C(N1)NN)N=C(N=C2NN)NN |
Computed by PubChem (NCBI)