Products 893724-52-2
CAS 893724-52-2 is the registry number for [(2,5-Dimethylphenyl)sulfonyl]acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,5-dimethylphenyl)sulfonylacetonitrile (CAS 893724-52-2) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)sulfonylacetonitrile. InChIKey: JWEASBGCALEXBS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)sulfonylacetonitrile |
| InChIKey | JWEASBGCALEXBS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)CC#N |
Computed by PubChem (NCBI)