CAS 893738-03-9 is the registry number for 5-(2,3,4,5,6-Pentafluorophenyl)-2-thiophenecarboxaldehyde, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
5-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carbaldehyde (CAS 893738-03-9) is a chemical compound with the molecular formula C11H3F5OS and a molecular weight of 278.20 g/mol. IUPAC name: 5-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carbaldehyde. InChIKey: NHCJNPJYECXGIU-UHFFFAOYSA-N.
| Molecular formula | C11H3F5OS |
|---|---|
| Molecular weight | 278.20 g/mol |
| IUPAC name | 5-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carbaldehyde |
| InChIKey | NHCJNPJYECXGIU-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C2=C(C(=C(C(=C2F)F)F)F)F)C=O |
Computed by PubChem (NCBI)