Products 893743-50-5
CAS 893743-50-5 is the registry number for 5-((3-Fluorophenoxy)methyl)furan-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(3-fluorophenoxy)methyl]furan-2-carboxylic acid (CAS 893743-50-5) is a chemical compound with the molecular formula C12H9FO4 and a molecular weight of 236.19 g/mol. IUPAC name: 5-[(3-fluorophenoxy)methyl]furan-2-carboxylic acid. InChIKey: UJAQNRUQURRIAO-UHFFFAOYSA-N.
| Molecular formula | C12H9FO4 |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | 5-[(3-fluorophenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | UJAQNRUQURRIAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OCC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)