CAS 893764-14-2 is the registry number for 8-((2-Hydroxyethyl)(methyl)amino)-1,3,9-trimethyl-3,9-dihydro-1H-purine-2,6-dione. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg, 10000mg.
8-[2-hydroxyethyl(methyl)amino]-1,3,9-trimethylpurine-2,6-dione (CAS 893764-14-2) is a chemical compound with the molecular formula C11H17N5O3 and a molecular weight of 267.28 g/mol. IUPAC name: 8-[2-hydroxyethyl(methyl)amino]-1,3,9-trimethylpurine-2,6-dione. InChIKey: QKADZAXCSWVQKB-UHFFFAOYSA-N.
| Molecular formula | C11H17N5O3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 8-[2-hydroxyethyl(methyl)amino]-1,3,9-trimethylpurine-2,6-dione |
| InChIKey | QKADZAXCSWVQKB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C(=O)N2C)C)N=C1N(C)CCO |
Computed by PubChem (NCBI)