CAS 893764-75-5 appears in our catalog under these names: [1,1-Dimethyl-2-(pentafluorophenoxy)ethyl]amine, 95%, (1,1-DImethyl-2-(pentafluorophenoxy)ethyl)amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-methyl-1-(2,3,4,5,6-pentafluorophenoxy)propan-2-amine (CAS 893764-75-5) is a chemical compound with the molecular formula C10H10F5NO and a molecular weight of 255.18 g/mol. IUPAC name: 2-methyl-1-(2,3,4,5,6-pentafluorophenoxy)propan-2-amine. InChIKey: OOGWLMYBYIPVKA-UHFFFAOYSA-N.
| Molecular formula | C10H10F5NO |
|---|---|
| Molecular weight | 255.18 g/mol |
| IUPAC name | 2-methyl-1-(2,3,4,5,6-pentafluorophenoxy)propan-2-amine |
| InChIKey | OOGWLMYBYIPVKA-UHFFFAOYSA-N |
| SMILES | CC(C)(COC1=C(C(=C(C(=C1F)F)F)F)F)N |
Computed by PubChem (NCBI)