CAS 893769-27-2 appears in our catalog under these names: N-[2-(1-Adamantyloxy)propyl]methanesulfonamide, 95%, N-(2-(Adamantan-1-yloxy)propyl)methanesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g, 5g.
N-[2-(1-adamantyloxy)propyl]methanesulfonamide (CAS 893769-27-2) is a chemical compound with the molecular formula C14H25NO3S and a molecular weight of 287.42 g/mol. IUPAC name: N-[2-(1-adamantyloxy)propyl]methanesulfonamide. InChIKey: ATARRJVSPKZNIA-UHFFFAOYSA-N.
| Molecular formula | C14H25NO3S |
|---|---|
| Molecular weight | 287.42 g/mol |
| IUPAC name | N-[2-(1-adamantyloxy)propyl]methanesulfonamide |
| InChIKey | ATARRJVSPKZNIA-UHFFFAOYSA-N |
| SMILES | CC(CNS(=O)(=O)C)OC12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)