CAS 894077-56-6 is the registry number for Benzaldehyde, 5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-methyl-. Offered by: Chemat. Available pack sizes: 1g.
5-[tert-butyl(dimethyl)silyl]oxy-2-methylbenzaldehyde (CAS 894077-56-6) is a chemical compound with the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. IUPAC name: 5-[tert-butyl(dimethyl)silyl]oxy-2-methylbenzaldehyde. InChIKey: VAOPJGLZTYLDKV-UHFFFAOYSA-N.
| Molecular formula | C14H22O2Si |
|---|---|
| Molecular weight | 250.41 g/mol |
| IUPAC name | 5-[tert-butyl(dimethyl)silyl]oxy-2-methylbenzaldehyde |
| InChIKey | VAOPJGLZTYLDKV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)O[Si](C)(C)C(C)(C)C)C=O |
Computed by PubChem (NCBI)