Products 894414-38-1

CAS 894414-38-1 is the registry number for tert-Butyl N-(2-aminoethoxy)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-aminoethoxy)carbamate (CAS 894414-38-1) is a chemical compound with the molecular formula C7H16N2O3 and a molecular weight of 176.21 g/mol. IUPAC name: tert-butyl N-(2-aminoethoxy)carbamate. InChIKey: UEHXCXYDRJQNEX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16N2O3
Molecular weight176.21 g/mol
IUPAC nametert-butyl N-(2-aminoethoxy)carbamate
InChIKeyUEHXCXYDRJQNEX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NOCCN

Computed by PubChem (NCBI)