Products 89461-49-4
CAS 89461-49-4 is the registry number for (10R)-Hepoxilin B3. Offered by: TRC. Available pack sizes: 25mg.
(10R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,8Z,14Z)-trienoic acid is an epoxy(hydroxy)icosatrienoic acid consisting of (5Z,8Z,14Z)-icosa-5,9,14-trienoic acid having additional (10R)-hydroxy- and (11S,12S)-epoxy groups. It is functionally related to an all-cis-icosa-5,8,14-trienoic acid. It is a conjugate acid of a (10R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,8Z,14Z)-trienoate.
Source: ChEBI
| Molecular formula | C20H32O4 |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | (5Z,8Z,10R)-10-hydroxy-10-[(2S,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoic acid |
| InChIKey | DWNBPRRXEVJMPO-OANGEUSWSA-N |
| SMILES | CCCCC/C=C\C[C@H]1[C@@H](O1)[C@@H](/C=C\C/C=C\CCCC(=O)O)O |
Computed by PubChem (NCBI)