CAS 89467-37-8 is the registry number for (R)-2-Methyl-1-((S)-1-phenylethyl)piperidin-4-one, 97%. Offered by: AmBeed. Available pack sizes: 5g, 25g, 10g.
(2R)-2-methyl-1-[(1S)-1-phenylethyl]piperidin-4-one (CAS 89467-37-8) is a chemical compound with the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. IUPAC name: (2R)-2-methyl-1-[(1S)-1-phenylethyl]piperidin-4-one. InChIKey: XOGIRAQPVLKDBV-NEPJUHHUSA-N.
| Molecular formula | C14H19NO |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | (2R)-2-methyl-1-[(1S)-1-phenylethyl]piperidin-4-one |
| InChIKey | XOGIRAQPVLKDBV-NEPJUHHUSA-N |
| SMILES | C[C@@H]1CC(=O)CCN1[C@@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)