CAS 894783-71-2 appears in our catalog under these names: Nintedanib Impurity 6 (Intedanib Impurity 6), Nintedanib Carboxylic Acid, >95% (HPLC), BIBF 1202/ 98.04% (existing batch purity), BIBF 1202, BIBF 1202 97%. Offered by: Chemat Brand, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 5mg, 100mg, 500mg, 0,1g.
2-hydroxy-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylic acid (CAS 894783-71-2) is a chemical compound with the molecular formula C30H31N5O4 and a molecular weight of 525.6 g/mol. IUPAC name: 2-hydroxy-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylic acid. InChIKey: SDJMWYVJAVLZEG-UHFFFAOYSA-N.
| Molecular formula | C30H31N5O4 |
|---|---|
| Molecular weight | 525.6 g/mol |
| IUPAC name | 2-hydroxy-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylic acid |
| InChIKey | SDJMWYVJAVLZEG-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC(=O)N(C)C2=CC=C(C=C2)N=C(C3=CC=CC=C3)C4=C(NC5=C4C=CC(=C5)C(=O)O)O |
Computed by PubChem (NCBI)