Products 89479-87-8

CAS 89479-87-8 appears in our catalog under these names: rel-(2S,6R)-2,6-diethylmorpholine, 95%, Morpholine, 2,6-diethyl-, cis-, 95%, 95%, cis-2,6-Diethylmorpholine, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.

(2R,6S)-2,6-diethylmorpholine (CAS 89479-87-8) is a chemical compound with the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. IUPAC name: (2R,6S)-2,6-diethylmorpholine. InChIKey: LPNZFNBNRWCBKA-OCAPTIKFSA-N.

Identity
Molecular formulaC8H17NO
Molecular weight143.23 g/mol
IUPAC name(2R,6S)-2,6-diethylmorpholine
InChIKeyLPNZFNBNRWCBKA-OCAPTIKFSA-N
SMILESCC[C@H]1CNC[C@H](O1)CC

Computed by PubChem (NCBI)