Products 895127-64-7
CAS 895127-64-7 appears in our catalog under these names: (±)13(14)-EpDPA, (±)13(14)–EpDPA, (±)13(14)-Epdpa, (±)13(14)-EpDPA, 95.0%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25ug, 50ug, 100ug, 500ug, 100μg, 25μg, 50μg, 500μg.
(4Z,7Z,10Z)-12-[(2S,3R)-3-[(2Z,5Z)-octa-2,5-dienyl]oxiran-2-yl]dodeca-4,7,10-trienoic acid (CAS 895127-64-7) is a chemical compound with the molecular formula C22H32O3 and a molecular weight of 344.5 g/mol. IUPAC name: (4Z,7Z,10Z)-12-[(2S,3R)-3-[(2Z,5Z)-octa-2,5-dienyl]oxiran-2-yl]dodeca-4,7,10-trienoic acid. InChIKey: DCFKVKFLEPMEGT-VABGYXHOSA-N.
| Molecular formula | C22H32O3 |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | (4Z,7Z,10Z)-12-[(2S,3R)-3-[(2Z,5Z)-octa-2,5-dienyl]oxiran-2-yl]dodeca-4,7,10-trienoic acid |
| InChIKey | DCFKVKFLEPMEGT-VABGYXHOSA-N |
| SMILES | CC/C=C\C/C=C\C[C@@H]1[C@@H](O1)C/C=C\C/C=C\C/C=C\CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(+/-)13(14)-EpDPA, (?)13(14)-EpDPA