CAS 895127-65-8 appears in our catalog under these names: (±)10(11)-EpDPA, (±)10(11)–EpDPA, (±)10(11)-Epdpa. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25ug, 50ug, 100ug, 500ug, 100μg, 25μg, 50μg, 500μg.
(4Z,7Z)-9-[(2S,3R)-3-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]oxiran-2-yl]nona-4,7-dienoic acid (CAS 895127-65-8) is a chemical compound with the molecular formula C22H32O3 and a molecular weight of 344.5 g/mol. IUPAC name: (4Z,7Z)-9-[(2S,3R)-3-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]oxiran-2-yl]nona-4,7-dienoic acid. InChIKey: YYZNJWZRJUGQCW-VABGYXHOSA-N.
| Molecular formula | C22H32O3 |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | (4Z,7Z)-9-[(2S,3R)-3-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]oxiran-2-yl]nona-4,7-dienoic acid |
| InChIKey | YYZNJWZRJUGQCW-VABGYXHOSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\C[C@@H]1[C@@H](O1)C/C=C\C/C=C\CCC(=O)O |
Computed by PubChem (NCBI)