CAS 895127-66-9 appears in our catalog under these names: (±)7(8)-EpDPA, (±)7(8)–EpDPA, (4Z)-6-(3-(2(Z),5(Z),8(Z),11Z)-2,5,8,11-Tetradecatetraen-1-yl-2-oxiranyl)-4-hexenoic acid. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25ug, 50ug, 100ug, 500ug, 100μg, 25μg, 50μg, 500μg.
(Z)-6-[(2S,3R)-3-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraenyl]oxiran-2-yl]hex-4-enoic acid (CAS 895127-66-9) is a chemical compound with the molecular formula C22H32O3 and a molecular weight of 344.5 g/mol. IUPAC name: (Z)-6-[(2S,3R)-3-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraenyl]oxiran-2-yl]hex-4-enoic acid. InChIKey: OHYKIJBTVXMLKX-JYFGGXQQSA-N.
| Molecular formula | C22H32O3 |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | (Z)-6-[(2S,3R)-3-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraenyl]oxiran-2-yl]hex-4-enoic acid |
| InChIKey | OHYKIJBTVXMLKX-JYFGGXQQSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@@H]1[C@@H](O1)C/C=C\CCC(=O)O |
Computed by PubChem (NCBI)