Products 895137-81-2
CAS 895137-81-2 appears in our catalog under these names: Deoxy Fesoterodine, Fesoterodine Impurity 10. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenyl] 2-methylpropanoate (CAS 895137-81-2) is a chemical compound with the molecular formula C26H37NO2 and a molecular weight of 395.6 g/mol. IUPAC name: [2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenyl] 2-methylpropanoate. InChIKey: LOMIYJWXUUAURU-QHCPKHFHSA-N.
| Molecular formula | C26H37NO2 |
|---|---|
| Molecular weight | 395.6 g/mol |
| IUPAC name | [2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenyl] 2-methylpropanoate |
| InChIKey | LOMIYJWXUUAURU-QHCPKHFHSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(=O)C(C)C)[C@@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)