CAS 89520-67-2 appears in our catalog under these names: 4-N-propylbenzenesulfinic acid sodium salt, 98%, Sodium 4-propylbenzenesulfinate, 97%, 97%, Sodium 4-propylbenzenesulfinate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
Sodium 4-propylbenzenesulfinate (CAS 89520-67-2) is a chemical compound with the molecular formula C9H11NaO2S and a molecular weight of 206.24 g/mol. IUPAC name: sodium 4-propylbenzenesulfinate. InChIKey: YZFJQTYHGXQSTN-UHFFFAOYSA-M.
| Molecular formula | C9H11NaO2S |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | sodium 4-propylbenzenesulfinate |
| InChIKey | YZFJQTYHGXQSTN-UHFFFAOYSA-M |
| SMILES | CCCC1=CC=C(C=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)