CAS 895241-94-8 is the registry number for (3R,4r)-tert-butyl 3-cyano-4-hydroxypyrrolidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3R,4R)-3-cyano-4-hydroxypyrrolidine-1-carboxylate (CAS 895241-94-8) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: tert-butyl (3R,4R)-3-cyano-4-hydroxypyrrolidine-1-carboxylate. InChIKey: IEGAWSYJCQMVBM-YUMQZZPRSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-cyano-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | IEGAWSYJCQMVBM-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)O)C#N |
Computed by PubChem (NCBI)