CAS 895525-75-4 appears in our catalog under these names: 3-Amino-4-methoxyphenylboronic acid hydrochloride, 96%, 3-Amino-4-methoxyphenylboronic acid hydrochloride, 95%, (3-Amino-4-methoxyphenyl)boronic acidhydrochloride, 96%, (3-Amino-4-methoxyphenyl)boronic acid hydrochloride, 96%. Offered by: Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 100mg, 1g, 5g, 250mg.
(3-amino-4-methoxyphenyl)boronic acid;hydrochloride (CAS 895525-75-4) is a chemical compound with the molecular formula C7H11BClNO3 and a molecular weight of 203.43 g/mol. IUPAC name: (3-amino-4-methoxyphenyl)boronic acid;hydrochloride. InChIKey: AFCUBRXMMOWVNQ-UHFFFAOYSA-N.
| Molecular formula | C7H11BClNO3 |
|---|---|
| Molecular weight | 203.43 g/mol |
| IUPAC name | (3-amino-4-methoxyphenyl)boronic acid;hydrochloride |
| InChIKey | AFCUBRXMMOWVNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)N)(O)O.Cl |
Computed by PubChem (NCBI)