Products 895542-96-8

CAS 895542-96-8 is the registry number for Trifarotene Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-[4-(2-acetyloxyethoxy)-3-bromophenyl]benzoate (CAS 895542-96-8) is a chemical compound with the molecular formula C19H19BrO5 and a molecular weight of 407.3 g/mol. IUPAC name: ethyl 4-[4-(2-acetyloxyethoxy)-3-bromophenyl]benzoate. InChIKey: DUWXVDDCFJIKBU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19BrO5
Molecular weight407.3 g/mol
IUPAC nameethyl 4-[4-(2-acetyloxyethoxy)-3-bromophenyl]benzoate
InChIKeyDUWXVDDCFJIKBU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)C2=CC(=C(C=C2)OCCOC(=O)C)Br

Computed by PubChem (NCBI)