Products 895696-66-9
CAS 895696-66-9 is the registry number for N-((3-Chlorophenyl)methyl)-4-fluorobenzamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
N-[(3-chlorophenyl)methyl]-4-fluorobenzamide (CAS 895696-66-9) is a chemical compound with the molecular formula C14H11ClFNO and a molecular weight of 263.69 g/mol. IUPAC name: N-[(3-chlorophenyl)methyl]-4-fluorobenzamide. InChIKey: OYQOEIBPVDUWJT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClFNO |
|---|---|
| Molecular weight | 263.69 g/mol |
| IUPAC name | N-[(3-chlorophenyl)methyl]-4-fluorobenzamide |
| InChIKey | OYQOEIBPVDUWJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CNC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)