CAS 895885-88-8 is the registry number for (4-(3-chloro-6-methylphenyl)piperazinyl)-N-(4-methylphenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-(5-chloro-2-methylphenyl)-N-(4-methylphenyl)piperazine-1-carboxamide (CAS 895885-88-8) is a chemical compound with the molecular formula C19H22ClN3O and a molecular weight of 343.8 g/mol. IUPAC name: 4-(5-chloro-2-methylphenyl)-N-(4-methylphenyl)piperazine-1-carboxamide. InChIKey: ZFISYMUVOPQLPA-UHFFFAOYSA-N.
| Molecular formula | C19H22ClN3O |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 4-(5-chloro-2-methylphenyl)-N-(4-methylphenyl)piperazine-1-carboxamide |
| InChIKey | ZFISYMUVOPQLPA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)N2CCN(CC2)C3=C(C=CC(=C3)Cl)C |
Computed by PubChem (NCBI)