CAS 895924-48-8 appears in our catalog under these names: 1-[(4-Isothiocyanatophenyl)sulfonyl]-1,2,3,4-tetrahydroquinoline, 95%, 1-((4-Isothiocyanatophenyl)sulfonyl)-1,2,3,4-tetrahydroquinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(4-isothiocyanatophenyl)sulfonyl-3,4-dihydro-2H-quinoline (CAS 895924-48-8) is a chemical compound with the molecular formula C16H14N2O2S2 and a molecular weight of 330.4 g/mol. IUPAC name: 1-(4-isothiocyanatophenyl)sulfonyl-3,4-dihydro-2H-quinoline. InChIKey: KIKROSFKSRRRLN-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2S2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 1-(4-isothiocyanatophenyl)sulfonyl-3,4-dihydro-2H-quinoline |
| InChIKey | KIKROSFKSRRRLN-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C1)S(=O)(=O)C3=CC=C(C=C3)N=C=S |
Computed by PubChem (NCBI)