CAS 896-33-3 appears in our catalog under these names: Ethyltriphenylphosphonium chloride, 98%, (Ethyl)triphenylphosphonium chloride, Ethyltriphenylphosphonium Chloride, >98.0%(HPLC)(T). Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 25g, 100g, 500g, 5g, on request.
Ethyl(triphenyl)phosphanium chloride (CAS 896-33-3) is a chemical compound with the molecular formula C20H20ClP and a molecular weight of 326.8 g/mol. IUPAC name: ethyl(triphenyl)phosphanium chloride. InChIKey: NJXBVBPTDHBAID-UHFFFAOYSA-M.
| Molecular formula | C20H20ClP |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | ethyl(triphenyl)phosphanium chloride |
| InChIKey | NJXBVBPTDHBAID-UHFFFAOYSA-M |
| SMILES | CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)