Products 89603-08-7
CAS 89603-08-7 is the registry number for tert-Pentyl-d6 Chloride. Offered by: TRC. Available pack sizes: 500mg, 50mg.
2-chloro-1,1,1-trideuterio-2-(trideuteriomethyl)butane (CAS 89603-08-7) is a chemical compound with the molecular formula C5H11Cl and a molecular weight of 112.63 g/mol. IUPAC name: 2-chloro-1,1,1-trideuterio-2-(trideuteriomethyl)butane. InChIKey: CRNIHJHMEQZAAS-XERRXZQWSA-N.
| Molecular formula | C5H11Cl |
|---|---|
| Molecular weight | 112.63 g/mol |
| IUPAC name | 2-chloro-1,1,1-trideuterio-2-(trideuteriomethyl)butane |
| InChIKey | CRNIHJHMEQZAAS-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])C(CC)(C([2H])([2H])[2H])Cl |
Computed by PubChem (NCBI)
Synonyms:
tert-Pentyl-d6 Chloride, tert-Pentyl-d6Chloride