Products 896115-68-7

CAS 896115-68-7 is the registry number for 1-(3-Bromo-1-adamantyl)pyrrolidine hydrobromide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(3-bromo-1-adamantyl)pyrrolidine;hydrobromide (CAS 896115-68-7) is a chemical compound with the molecular formula C14H23Br2N and a molecular weight of 365.15 g/mol. IUPAC name: 1-(3-bromo-1-adamantyl)pyrrolidine;hydrobromide. InChIKey: XTUYVGMTLWKKGF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23Br2N
Molecular weight365.15 g/mol
IUPAC name1-(3-bromo-1-adamantyl)pyrrolidine;hydrobromide
InChIKeyXTUYVGMTLWKKGF-UHFFFAOYSA-N
SMILESC1CCN(C1)C23CC4CC(C2)CC(C4)(C3)Br.Br

Computed by PubChem (NCBI)