Products 896117-64-9
CAS 896117-64-9 is the registry number for GSK931145. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]-2,6-dimethylbenzamide (CAS 896117-64-9) is a chemical compound with the molecular formula C23H30N2O and a molecular weight of 350.5 g/mol. IUPAC name: N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]-2,6-dimethylbenzamide. InChIKey: BMXRRRIDMAIEKX-UHFFFAOYSA-N.
| Molecular formula | C23H30N2O |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | N-[[1-(dimethylamino)cyclopentyl]-phenylmethyl]-2,6-dimethylbenzamide |
| InChIKey | BMXRRRIDMAIEKX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)NC(C2=CC=CC=C2)C3(CCCC3)N(C)C |
Computed by PubChem (NCBI)