CAS 896161-09-4 is the registry number for 2-Acetamido-5-amino-3-bromopyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(5-amino-3-bromo-2-pyridinyl)acetamide (CAS 896161-09-4) is a chemical compound with the molecular formula C7H8BrN3O and a molecular weight of 230.06 g/mol. IUPAC name: N-(5-amino-3-bromo-2-pyridinyl)acetamide. InChIKey: PLNRSPZYYCMLTP-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | N-(5-amino-3-bromo-2-pyridinyl)acetamide |
| InChIKey | PLNRSPZYYCMLTP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=N1)N)Br |
Computed by PubChem (NCBI)