Products 89626-38-0
CAS 89626-38-0 appears in our catalog under these names: Ac–Pro–Leu–Gly–OH, Ac-Pro-Leu-Gly-OH. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 1000mg, 500mg, 2000mg, Get quote.
2-[[(2S)-2-[[(2S)-1-acetylpyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetic acid (CAS 89626-38-0) is a chemical compound with the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. IUPAC name: 2-[[(2S)-2-[[(2S)-1-acetylpyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetic acid. InChIKey: CFWJDQIPIHDYBS-RYUDHWBXSA-N.
| Molecular formula | C15H25N3O5 |
|---|---|
| Molecular weight | 327.38 g/mol |
| IUPAC name | 2-[[(2S)-2-[[(2S)-1-acetylpyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetic acid |
| InChIKey | CFWJDQIPIHDYBS-RYUDHWBXSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)C |
Computed by PubChem (NCBI)