Products 89639-43-0

CAS 89639-43-0 is the registry number for 3-Chloro-cyclobutane-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-chlorocyclobutane-1,1-dicarboxylic acid (CAS 89639-43-0) is a chemical compound with the molecular formula C6H7ClO4 and a molecular weight of 178.57 g/mol. IUPAC name: 3-chlorocyclobutane-1,1-dicarboxylic acid. InChIKey: CUTCKBJFLZZDDX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClO4
Molecular weight178.57 g/mol
IUPAC name3-chlorocyclobutane-1,1-dicarboxylic acid
InChIKeyCUTCKBJFLZZDDX-UHFFFAOYSA-N
SMILESC1C(CC1(C(=O)O)C(=O)O)Cl

Computed by PubChem (NCBI)