Products 896472-94-9

CAS 896472-94-9 is the registry number for FTY720 Hexanoic Acid Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

6-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]phenyl]hexanoic acid;hydrochloride (CAS 896472-94-9) is a chemical compound with the molecular formula C17H28ClNO4 and a molecular weight of 345.9 g/mol. IUPAC name: 6-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]phenyl]hexanoic acid;hydrochloride. InChIKey: JATFSDUKMOHUEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H28ClNO4
Molecular weight345.9 g/mol
IUPAC name6-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]phenyl]hexanoic acid;hydrochloride
InChIKeyJATFSDUKMOHUEQ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCCCCC(=O)O)CCC(CO)(CO)N.Cl

Computed by PubChem (NCBI)