CAS 896729-08-1 appears in our catalog under these names: Imrecoxib Impurity 3, 4'-Aarboxylic acid imrecoxib, 99.29%, Imrecoxib Impurity 3-d7. Offered by: Chemat Brand, Hubei YoungXin, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg, 5 mg.
4-[3-(4-methylsulfonylphenyl)-5-oxo-1-propyl-2H-pyrrol-4-yl]benzoic acid (CAS 896729-08-1) is a chemical compound with the molecular formula C21H21NO5S and a molecular weight of 399.5 g/mol. IUPAC name: 4-[3-(4-methylsulfonylphenyl)-5-oxo-1-propyl-2H-pyrrol-4-yl]benzoic acid. InChIKey: UOLUFPJCRSHVKK-UHFFFAOYSA-N.
| Molecular formula | C21H21NO5S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | 4-[3-(4-methylsulfonylphenyl)-5-oxo-1-propyl-2H-pyrrol-4-yl]benzoic acid |
| InChIKey | UOLUFPJCRSHVKK-UHFFFAOYSA-N |
| SMILES | CCCN1CC(=C(C1=O)C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)