Products 897026-79-8

CAS 897026-79-8 is the registry number for 2,5-Dibromo-4-methoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

2,5-Dibromo-4-methoxybenzene-1-sulfonyl chloride
Biosynth
  • size: 50mg, 0,5g
  • Variants: 2
View product
Structural formula: {0} (CAS {1})

2,5-dibromo-4-methoxybenzenesulfonyl chloride (CAS 897026-79-8) is a chemical compound with the molecular formula C7H5Br2ClO3S and a molecular weight of 364.44 g/mol. IUPAC name: 2,5-dibromo-4-methoxybenzenesulfonyl chloride. InChIKey: IKLHTRGEYKAJSA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Br2ClO3S
Molecular weight364.44 g/mol
IUPAC name2,5-dibromo-4-methoxybenzenesulfonyl chloride
InChIKeyIKLHTRGEYKAJSA-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1Br)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)

Synonyms: 2,5-dibromo-4-methoxybenzene-1-sulfonyl chloride, 2,5-Dibromo-4-methoxybenzenesulfonyl chloride, starbld0046534
Isomers (same molecular formula)
2,4-dibromo-5-methoxybenzenesulfonyl chloride C7H5Br2ClO3S