CAS 89711-85-3 appears in our catalog under these names: Sodium 1,4,5,6-tetrahydropyridine-2-carboxylate, 95%, Sodium 1,4,5,6-tetrahydropyridine-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 1,2,3,4-tetrahydropyridine-6-carboxylate (CAS 89711-85-3) is a chemical compound with the molecular formula C6H8NNaO2 and a molecular weight of 149.12 g/mol. IUPAC name: sodium 1,2,3,4-tetrahydropyridine-6-carboxylate. InChIKey: ZBFSJZFYEBPLGV-UHFFFAOYSA-M.
| Molecular formula | C6H8NNaO2 |
|---|---|
| Molecular weight | 149.12 g/mol |
| IUPAC name | sodium 1,2,3,4-tetrahydropyridine-6-carboxylate |
| InChIKey | ZBFSJZFYEBPLGV-UHFFFAOYSA-M |
| SMILES | C1CC=C(NC1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)