CAS 89717-81-7 is the registry number for 4’-Methoxypropiophenone-d3. Offered by: TRC. Available pack sizes: 250mg, 25mg.
3,3,3-trideuterio-1-(4-methoxyphenyl)propan-1-one (CAS 89717-81-7) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 167.22 g/mol. IUPAC name: 3,3,3-trideuterio-1-(4-methoxyphenyl)propan-1-one. InChIKey: ZJVAWPKTWVFKHG-FIBGUPNXSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 167.22 g/mol |
| IUPAC name | 3,3,3-trideuterio-1-(4-methoxyphenyl)propan-1-one |
| InChIKey | ZJVAWPKTWVFKHG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)