CAS 897365-76-3 is the registry number for 6-Chloro-3-(3-chloro-2-fluorobenzylidene)indolin-2-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 25g.
(3Z)-6-chloro-3-[(3-chloro-2-fluorophenyl)methylidene]-1H-indol-2-one (CAS 897365-76-3) is a chemical compound with the molecular formula C15H8Cl2FNO and a molecular weight of 308.1 g/mol. IUPAC name: (3Z)-6-chloro-3-[(3-chloro-2-fluorophenyl)methylidene]-1H-indol-2-one. InChIKey: BLLDULGTZRWONK-WDZFZDKYSA-N.
| Molecular formula | C15H8Cl2FNO |
|---|---|
| Molecular weight | 308.1 g/mol |
| IUPAC name | (3Z)-6-chloro-3-[(3-chloro-2-fluorophenyl)methylidene]-1H-indol-2-one |
| InChIKey | BLLDULGTZRWONK-WDZFZDKYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)/C=C\2/C3=C(C=C(C=C3)Cl)NC2=O |
Computed by PubChem (NCBI)