Products 897566-25-5

CAS 897566-25-5 is the registry number for 2-(4-(tert-Butyl)phenyl)-8-methylquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-tert-butylphenyl)-8-methylquinoline-4-carboxylic acid (CAS 897566-25-5) is a chemical compound with the molecular formula C21H21NO2 and a molecular weight of 319.4 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-8-methylquinoline-4-carboxylic acid. InChIKey: SBTBJAYREODURC-UHFFFAOYSA-N.

Identity
Molecular formulaC21H21NO2
Molecular weight319.4 g/mol
IUPAC name2-(4-tert-butylphenyl)-8-methylquinoline-4-carboxylic acid
InChIKeySBTBJAYREODURC-UHFFFAOYSA-N
SMILESCC1=C2C(=CC=C1)C(=CC(=N2)C3=CC=C(C=C3)C(C)(C)C)C(=O)O

Computed by PubChem (NCBI)