CAS 89770-41-2 appears in our catalog under these names: 8-Methylcinnolin-4-amine, 97%, 8-Methylcinnolin-4-amine, 98%, 98%, 8-Methylcinnolin-4-amine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg.
8-methylcinnolin-4-amine (CAS 89770-41-2) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: 8-methylcinnolin-4-amine. InChIKey: WVKMSDVQKSFKBG-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 8-methylcinnolin-4-amine |
| InChIKey | WVKMSDVQKSFKBG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN=N2)N |
Computed by PubChem (NCBI)