Products 89790-15-8

CAS 89790-15-8 is the registry number for Hexadecanediamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Hexadecanediamide (CAS 89790-15-8) is a chemical compound with the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. IUPAC name: hexadecanediamide. InChIKey: YPTKZEUCJCUXDE-UHFFFAOYSA-N.

Identity
Molecular formulaC16H32N2O2
Molecular weight284.44 g/mol
IUPAC namehexadecanediamide
InChIKeyYPTKZEUCJCUXDE-UHFFFAOYSA-N
SMILESC(CCCCCCCC(=O)N)CCCCCCC(=O)N

Computed by PubChem (NCBI)

Synonyms: Hexadecanediamide