CAS 89792-36-9 is the registry number for ethyl ((5-nitro-1,3-thiazol-2-yl)amino)(oxo)acetate, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
Ethyl 2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoacetate (CAS 89792-36-9) is a chemical compound with the molecular formula C7H7N3O5S and a molecular weight of 245.22 g/mol. IUPAC name: ethyl 2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoacetate. InChIKey: QSWNJRYMPUDHGF-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O5S |
|---|---|
| Molecular weight | 245.22 g/mol |
| IUPAC name | ethyl 2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoacetate |
| InChIKey | QSWNJRYMPUDHGF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=NC=C(S1)[N+](=O)[O-] |
Computed by PubChem (NCBI)