CAS 897952-14-6 appears in our catalog under these names: (6-(2-Methoxy-2-oxoethoxy)pyridin-3-yl)boronic acid, 98%, (6-(2-Methoxy-2-oxoethoxy)pyridin-3-yl)boronic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
[6-(2-methoxy-2-oxoethoxy)-3-pyridinyl]boronic acid (CAS 897952-14-6) is a chemical compound with the molecular formula C8H10BNO5 and a molecular weight of 210.98 g/mol. IUPAC name: [6-(2-methoxy-2-oxoethoxy)-3-pyridinyl]boronic acid. InChIKey: RSEOANUIYJWZMM-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO5 |
|---|---|
| Molecular weight | 210.98 g/mol |
| IUPAC name | [6-(2-methoxy-2-oxoethoxy)-3-pyridinyl]boronic acid |
| InChIKey | RSEOANUIYJWZMM-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)OCC(=O)OC)(O)O |
Computed by PubChem (NCBI)