CAS 89813-56-9 appears in our catalog under these names: Hydrochlorothiazide Impurity 21, Hydrochlorothiazide Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1,1,3-trioxo-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (CAS 89813-56-9) is a chemical compound with the molecular formula C7H6ClN3O5S2 and a molecular weight of 311.7 g/mol. IUPAC name: 6-chloro-1,1,3-trioxo-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide. InChIKey: CLWJBTNSDQIMNT-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O5S2 |
|---|---|
| Molecular weight | 311.7 g/mol |
| IUPAC name | 6-chloro-1,1,3-trioxo-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | CLWJBTNSDQIMNT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)S(=O)(=O)N)S(=O)(=O)NC(=O)N2 |
Computed by PubChem (NCBI)