CAS 89814-62-0 appears in our catalog under these names: 2,5-Di(2-thienyl)-1h-pyrrole, 95%, 2,5-Di(2-thienyl)-1H-pyrrole, 2,5–Di(2–thienyl)–1H–pyrrole. Offered by: Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg, 200mg.
2,5-dithiophen-2-yl-1H-pyrrole (CAS 89814-62-0) is a chemical compound with the molecular formula C12H9NS2 and a molecular weight of 231.3 g/mol. IUPAC name: 2,5-dithiophen-2-yl-1H-pyrrole. InChIKey: REHRCHHNCOTPBV-UHFFFAOYSA-N.
| Molecular formula | C12H9NS2 |
|---|---|
| Molecular weight | 231.3 g/mol |
| IUPAC name | 2,5-dithiophen-2-yl-1H-pyrrole |
| InChIKey | REHRCHHNCOTPBV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(N2)C3=CC=CS3 |
Computed by PubChem (NCBI)