Products 898203-28-6
CAS 898203-28-6 is the registry number for GRIN2A modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[(4-fluorophenyl)sulfonylamino]methyl]-N-(pyridin-3-ylmethyl)benzamide (CAS 898203-28-6) is a chemical compound with the molecular formula C20H18FN3O3S and a molecular weight of 399.4 g/mol. IUPAC name: 4-[[(4-fluorophenyl)sulfonylamino]methyl]-N-(pyridin-3-ylmethyl)benzamide. InChIKey: XVMFFIALWXXWPW-UHFFFAOYSA-N.
| Molecular formula | C20H18FN3O3S |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 4-[[(4-fluorophenyl)sulfonylamino]methyl]-N-(pyridin-3-ylmethyl)benzamide |
| InChIKey | XVMFFIALWXXWPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC(=O)C2=CC=C(C=C2)CNS(=O)(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)