CAS 898227-07-1 is the registry number for tert-Butyl 4-(3-chloro-5-(isopropoxycarbonyl)pyridin-2-yl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(3-chloro-5-propan-2-yloxycarbonyl-2-pyridinyl)piperazine-1-carboxylate (CAS 898227-07-1) is a chemical compound with the molecular formula C18H26ClN3O4 and a molecular weight of 383.9 g/mol. IUPAC name: tert-butyl 4-(3-chloro-5-propan-2-yloxycarbonyl-2-pyridinyl)piperazine-1-carboxylate. InChIKey: NPSXXWFOWRXJCW-UHFFFAOYSA-N.
| Molecular formula | C18H26ClN3O4 |
|---|---|
| Molecular weight | 383.9 g/mol |
| IUPAC name | tert-butyl 4-(3-chloro-5-propan-2-yloxycarbonyl-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | NPSXXWFOWRXJCW-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(N=C1)N2CCN(CC2)C(=O)OC(C)(C)C)Cl |
Computed by PubChem (NCBI)