CAS 89825-69-4 is the registry number for L-641953. Offered by: MedChemExpress. Available pack sizes: Get quote.
(11R)-3-fluoro-11-oxobenzo[b][1]benzothiepine-9-carboxylic acid (CAS 89825-69-4) is a chemical compound with the molecular formula C15H9FO3S and a molecular weight of 288.29 g/mol. IUPAC name: (11R)-3-fluoro-11-oxobenzo[b][1]benzothiepine-9-carboxylic acid. InChIKey: SAHGCTPARQWSQG-HXUWFJFHSA-N.
| Molecular formula | C15H9FO3S |
|---|---|
| Molecular weight | 288.29 g/mol |
| IUPAC name | (11R)-3-fluoro-11-oxobenzo[b][1]benzothiepine-9-carboxylic acid |
| InChIKey | SAHGCTPARQWSQG-HXUWFJFHSA-N |
| SMILES | C1=CC(=CC2=C1C=CC3=C([S@]2=O)C=CC(=C3)F)C(=O)O |
Computed by PubChem (NCBI)