CAS 898288-88-5 is the registry number for Pentafluorophenyl 1-methyl-1H-imidazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg.
(2,3,4,5,6-pentafluorophenyl) 1-methylimidazole-4-carboxylate (CAS 898288-88-5) is a chemical compound with the molecular formula C11H5F5N2O2 and a molecular weight of 292.16 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 1-methylimidazole-4-carboxylate. InChIKey: IWTPHWSECNQILQ-UHFFFAOYSA-N.
| Molecular formula | C11H5F5N2O2 |
|---|---|
| Molecular weight | 292.16 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 1-methylimidazole-4-carboxylate |
| InChIKey | IWTPHWSECNQILQ-UHFFFAOYSA-N |
| SMILES | CN1C=C(N=C1)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)